C18H17ClFNO3 — CID 88880163
3-[4-(4-chlorophenoxy)piperidin-1-yl]-2-fluoro-6-hydroxybenzaldehyde (PubChem CID 88880163) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is 3-[4-(4-chlorophenoxy)piperidin-1-yl]-2-fluoro-6-hydroxybenzaldehyde.
| Compound Name | 3-[4-(4-chlorophenoxy)piperidin-1-yl]-2-fluoro-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 88880163 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-[4-(4-chlorophenoxy)piperidin-1-yl]-2-fluoro-6-hydroxybenzaldehyde |
| SMILES | O=Cc1c(O)ccc(N2CCC(Oc3ccc(Cl)cc3)CC2)c1F |
| InChI | InChI=1S/C18H17ClFNO3/c19-12-1-3-13(4-2-12)24-14-7-9-21(10-8-14)16-5-6-17(23)15(11-22)18(16)20/h1-6,11,14,23H,7-10H2 |
| InChIKey | VRDGFZLOQZIBRC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|