C25H42N6O7 — CID 88887066
tert-butyl 4-[(2S)-2-[4-(2-formyloxyethyl)triazol-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperazine-1-carboxylate (PubChem CID 88887066) has the molecular formula C25H42N6O7 and a molecular weight of 538.65 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-[4-(2-formyloxyethyl)triazol-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-2-[4-(2-formyloxyethyl)triazol-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88887066 |
| Molecular Formula | C25H42N6O7 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | tert-butyl 4-[(2S)-2-[4-(2-formyloxyethyl)triazol-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)N1CCN(C(=O)OC(C)(C)C)CC1)n1cc(CCOC=O)nn1 |
| InChI | InChI=1S/C25H42N6O7/c1-24(2,3)37-22(34)26-11-8-7-9-20(31-17-19(27-28-31)10-16-36-18-32)21(33)29-12-14-30(15-13-29)23(35)38-25(4,5)6/h17-18,20H,7-16H2,1-6H3,(H,26,34)/t20-/m0/s1 |
| InChIKey | WRKOCVGFKLXWKG-FQEVSTJZSA-N |
| XLogP | 2.31 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|