C29H35N5O4 — CID 88888618
tert-butyl 4-[[4-[6-[(E)-C-(2-formylcyclopropyl)-N-(methylamino)carbonimidoyl]-1,3-benzoxazol-2-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 88888618) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is tert-butyl 4-[[4-[6-[(E)-C-(2-formylcyclopropyl)-N-(methylamino)carbonimidoyl]-1,3-benzoxazol-2-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[6-[(E)-C-(2-formylcyclopropyl)-N-(methylamino)carbonimidoyl]-1,3-benzoxazol-2-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88888618 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | tert-butyl 4-[[4-[6-[(E)-C-(2-formylcyclopropyl)-N-(methylamino)carbonimidoyl]-1,3-benzoxazol-2-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CN/N=C(/c1ccc2nc(-c3ccc(CN4CCN(C(=O)OC(C)(C)C)CC4)cc3)oc2c1)C1CC1C=O |
| InChI | InChI=1S/C29H35N5O4/c1-29(2,3)38-28(36)34-13-11-33(12-14-34)17-19-5-7-20(8-6-19)27-31-24-10-9-21(16-25(24)37-27)26(32-30-4)23-15-22(23)18-35/h5-10,16,18,22-23,30H,11-15,17H2,1-4H3/b32-26- |
| InChIKey | PNHXHDCJTXMQIM-FSRJSHLRSA-N |
| XLogP | 4.31 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|