C9H16N2O2S — CID 88888785
prop-1-en-2-yl N-[(2R)-1-(ethylamino)-1-sulfanylidenepropan-2-yl]carbamate (PubChem CID 88888785) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is prop-1-en-2-yl N-[(2R)-1-(ethylamino)-1-sulfanylidenepropan-2-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[(2R)-1-(ethylamino)-1-sulfanylidenepropan-2-yl]carbamate |
|---|---|
| PubChem CID | 88888785 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | prop-1-en-2-yl N-[(2R)-1-(ethylamino)-1-sulfanylidenepropan-2-yl]carbamate |
| SMILES | C=C(C)OC(=O)N[C@H](C)C(=S)NCC |
| InChI | InChI=1S/C9H16N2O2S/c1-5-10-8(14)7(4)11-9(12)13-6(2)3/h7H,2,5H2,1,3-4H3,(H,10,14)(H,11,12)/t7-/m1/s1 |
| InChIKey | GYCSWLOCAXSSOR-SSDOTTSWSA-N |
| XLogP | 1.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|