C10H16N2O6 — CID 88942115
methyl (2S)-3-[(2-hydroxyacetyl)amino]-2-(prop-1-en-2-yloxycarbonylamino)propanoate (PubChem CID 88942115) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl (2S)-3-[(2-hydroxyacetyl)amino]-2-(prop-1-en-2-yloxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-[(2-hydroxyacetyl)amino]-2-(prop-1-en-2-yloxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 88942115 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl (2S)-3-[(2-hydroxyacetyl)amino]-2-(prop-1-en-2-yloxycarbonylamino)propanoate |
| SMILES | C=C(C)OC(=O)N[C@@H](CNC(=O)CO)C(=O)OC |
| InChI | InChI=1S/C10H16N2O6/c1-6(2)18-10(16)12-7(9(15)17-3)4-11-8(14)5-13/h7,13H,1,4-5H2,2-3H3,(H,11,14)(H,12,16)/t7-/m0/s1 |
| InChIKey | ZHFRCDKCFQBPOJ-ZETCQYMHSA-N |
| XLogP | -1.10 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|