C7H12N2O3 — CID 88901077
prop-1-en-2-yl N-(3-amino-3-oxopropyl)carbamate (PubChem CID 88901077) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is prop-1-en-2-yl N-(3-amino-3-oxopropyl)carbamate.
| Compound Name | prop-1-en-2-yl N-(3-amino-3-oxopropyl)carbamate |
|---|---|
| PubChem CID | 88901077 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | prop-1-en-2-yl N-(3-amino-3-oxopropyl)carbamate |
| SMILES | C=C(C)OC(=O)NCCC(N)=O |
| InChI | InChI=1S/C7H12N2O3/c1-5(2)12-7(11)9-4-3-6(8)10/h1,3-4H2,2H3,(H2,8,10)(H,9,11) |
| InChIKey | HTRMGLOZQIUPEN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|