C15H19N5O — CID 8888927
N-(4-methylpiperazin-1-yl)-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 8888927) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 8888927 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CN1CCN(NC(=O)c2cc(-c3ccccc3)n[nH]2)CC1 |
| InChI | InChI=1S/C15H19N5O/c1-19-7-9-20(10-8-19)18-15(21)14-11-13(16-17-14)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H,16,17)(H,18,21) |
| InChIKey | YTORZPNKFJCLTO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |