C28H38F3N5O3 — CID 88890468
N'-[(2Z)-1-[4-[[(4S)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]methanimidamide (PubChem CID 88890468) has the molecular formula C28H38F3N5O3 and a molecular weight of 549.64 g/mol. Its IUPAC name is N'-[(2Z)-1-[4-[[(4S)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z)-1-[4-[[(4S)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 88890468 |
| Molecular Formula | C28H38F3N5O3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | N'-[(2Z)-1-[4-[[(4S)-3-methoxyoxan-4-yl]amino]piperidin-1-yl]-3-methyl-1-oxo-4-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]penta-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(/C(C)=C(\N=C\N)C(=O)N1CCC(N[C@H]2CCOCC2OC)CC1)N1CCc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C28H38F3N5O3/c1-18(19(2)36-10-6-20-4-5-22(28(29,30)31)14-21(20)15-36)26(33-17-32)27(37)35-11-7-23(8-12-35)34-24-9-13-39-16-25(24)38-3/h4-5,14,17,23-25,34H,2,6-13,15-16H2,1,3H3,(H2,32,33)/b26-18-/t24-,25?/m0/s1 |
| InChIKey | QCDAKJXGBHMVRU-QLQVWOTOSA-N |
| XLogP | 3.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|