C25H50N2O — CID 88891161
N',N'-dimethyl-N-[[(10Z,13Z)-nonadeca-10,13-dienoxy]methyl]propane-1,3-diamine (PubChem CID 88891161) has the molecular formula C25H50N2O and a molecular weight of 394.69 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[(10Z,13Z)-nonadeca-10,13-dienoxy]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[[(10Z,13Z)-nonadeca-10,13-dienoxy]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 88891161 |
| Molecular Formula | C25H50N2O |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.39 |
| IUPAC Name | N',N'-dimethyl-N-[[(10Z,13Z)-nonadeca-10,13-dienoxy]methyl]propane-1,3-diamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCOCNCCCN(C)C |
| InChI | InChI=1S/C25H50N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-28-25-26-22-21-23-27(2)3/h8-9,11-12,26H,4-7,10,13-25H2,1-3H3/b9-8-,12-11- |
| InChIKey | GTEARRKBSLBXCW-MURFETPASA-N |
| XLogP | 6.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|