C18H16O2 — CID 88897284
1-(3-methoxy-9H-fluoren-9-yl)but-3-yn-1-ol (PubChem CID 88897284) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(3-methoxy-9H-fluoren-9-yl)but-3-yn-1-ol.
| Compound Name | 1-(3-methoxy-9H-fluoren-9-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 88897284 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(3-methoxy-9H-fluoren-9-yl)but-3-yn-1-ol |
| SMILES | C#CCC(O)C1c2ccccc2-c2cc(OC)ccc21 |
| InChI | InChI=1S/C18H16O2/c1-3-6-17(19)18-14-8-5-4-7-13(14)16-11-12(20-2)9-10-15(16)18/h1,4-5,7-11,17-19H,6H2,2H3 |
| InChIKey | JUPHFWNKSYWQNE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|