C20H20O2 — CID 58482061
1-(3-methoxy-6-methyl-9,10-dihydroanthracen-9-yl)but-3-yn-1-ol (PubChem CID 58482061) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(3-methoxy-6-methyl-9,10-dihydroanthracen-9-yl)but-3-yn-1-ol.
| Compound Name | 1-(3-methoxy-6-methyl-9,10-dihydroanthracen-9-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 58482061 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-(3-methoxy-6-methyl-9,10-dihydroanthracen-9-yl)but-3-yn-1-ol |
| SMILES | C#CCC(O)C1c2ccc(C)cc2Cc2cc(OC)ccc21 |
| InChI | InChI=1S/C20H20O2/c1-4-5-19(21)20-17-8-6-13(2)10-14(17)11-15-12-16(22-3)7-9-18(15)20/h1,6-10,12,19-21H,5,11H2,2-3H3 |
| InChIKey | MVPYGRMURJSQCC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|