C64H90Cl4N4 — CID 88901794
2-chloro-4-N-[4-(3-chloro-N-(3-chloro-4-methylphenyl)-4-methylanilino)phenyl]-4-N-[3-chloro-4-(dioctylamino)phenyl]-1-N,1-N-dioctylbenzene-1,4-diamine (PubChem CID 88901794) has the molecular formula C64H90Cl4N4 and a molecular weight of 1057.26 g/mol. Its IUPAC name is 2-chloro-4-N-[4-(3-chloro-N-(3-chloro-4-methylphenyl)-4-methylanilino)phenyl]-4-N-[3-chloro-4-(dioctylamino)phenyl]-1-N,1-N-dioctylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[4-(3-chloro-N-(3-chloro-4-methylphenyl)-4-methylanilino)phenyl]-4-N-[3-chloro-4-(dioctylamino)phenyl]-1-N,1-N-dioctylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 88901794 |
| Molecular Formula | C64H90Cl4N4 |
| Molecular Weight | 1057.26 g/mol |
| Exact Mass | 1054.59 |
| IUPAC Name | 2-chloro-4-N-[4-(3-chloro-N-(3-chloro-4-methylphenyl)-4-methylanilino)phenyl]-4-N-[3-chloro-4-(dioctylamino)phenyl]-1-N,1-N-dioctylbenzene-1,4-diamine |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(N(c2ccc(N(c3ccc(C)c(Cl)c3)c3ccc(C)c(Cl)c3)cc2)c2ccc(N(CCCCCCCC)CCCCCCCC)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C64H90Cl4N4/c1-7-11-15-19-23-27-43-69(44-28-24-20-16-12-8-2)63-41-39-57(49-61(63)67)72(58-40-42-64(62(68)50-58)70(45-29-25-21-17-13-9-3)46-30-26-22-18-14-10-4)54-37-35-53(36-38-54)71(55-33-31-51(5)59(65)47-55)56-34-32-52(6)60(66)48-56/h31-42,47-50H,7-30,43-46H2,1-6H3 |
| InChIKey | KTZXMQOGCGWROI-UHFFFAOYSA-N |
| XLogP | 22.91 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.26 |
| LogP ≤ 5 | 22.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|