C15H19N2O8P — CID 88901948
[(2R,5R)-4-hydroxy-2-(methoxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 88901948) has the molecular formula C15H19N2O8P and a molecular weight of 386.30 g/mol. Its IUPAC name is [(2R,5R)-4-hydroxy-2-(methoxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [(2R,5R)-4-hydroxy-2-(methoxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 88901948 |
| Molecular Formula | C15H19N2O8P |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [(2R,5R)-4-hydroxy-2-(methoxymethyl)-5-(5-nitroindol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COC[C@H]1O[C@@H](n2ccc3cc([N+](=O)[O-])ccc32)C(O)C1OP(C)(=O)O |
| InChI | InChI=1S/C15H19N2O8P/c1-23-8-12-14(25-26(2,21)22)13(18)15(24-12)16-6-5-9-7-10(17(19)20)3-4-11(9)16/h3-7,12-15,18H,8H2,1-2H3,(H,21,22)/t12-,13?,14?,15-/m1/s1 |
| InChIKey | XNUFZXBTIDAJKG-XSCHDIRWSA-N |
| XLogP | 1.65 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|