C35H52F4O5S — CID 88902157
4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 88902157) has the molecular formula C35H52F4O5S and a molecular weight of 660.86 g/mol. Its IUPAC name is 4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 88902157 |
| Molecular Formula | C35H52F4O5S |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 4-[2-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(OCCOc5c(F)c(F)c(S(=O)(=O)O)c(F)c5F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H52F4O5S/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(13-15-34(22,4)27(24)14-16-35(25,26)5)43-17-18-44-32-28(36)30(38)33(45(40,41)42)31(39)29(32)37/h20-27H,6-19H2,1-5H3,(H,40,41,42) |
| InChIKey | BHSZCBPLDHRSQJ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|