C33H48F4O4S — CID 89153458
4-[[(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 89153458) has the molecular formula C33H48F4O4S and a molecular weight of 616.80 g/mol. Its IUPAC name is 4-[[(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-[[(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 89153458 |
| Molecular Formula | C33H48F4O4S |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | 4-[[(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4C[C@@H](Oc5c(F)c(F)c(S(=O)(=O)O)c(F)c5F)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C33H48F4O4S/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(13-15-32(20,4)25(22)14-16-33(23,24)5)41-30-26(34)28(36)31(42(38,39)40)29(37)27(30)35/h18-25H,6-17H2,1-5H3,(H,38,39,40)/t19?,20?,21-,22?,23?,24?,25?,32-,33+/m0/s1 |
| InChIKey | GMOMLGKPOIASTC-DCCVWNLESA-N |
| XLogP | 9.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|