C33H34CoO9-2 — CID 88909203
oxocobalt;4-(phenoxy)butyl prop-2-enoate;phenyl 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 88909203) has the molecular formula C33H34CoO9-2 and a molecular weight of 633.56 g/mol. Its IUPAC name is oxocobalt;4-(phenoxy)butyl prop-2-enoate;phenyl 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | oxocobalt;4-(phenoxy)butyl prop-2-enoate;phenyl 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 88909203 |
| Molecular Formula | C33H34CoO9-2 |
| Molecular Weight | 633.56 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | oxocobalt;4-(phenoxy)butyl prop-2-enoate;phenyl 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1cc[c-]cc1.C=CC(=O)OCCCCOc1ccc(C(=O)Oc2cc[c-]cc2)cc1.O=[Co] |
| InChI | InChI=1S/C20H19O5.C13H15O3.Co.O/c1-2-19(21)24-15-7-6-14-23-17-12-10-16(11-13-17)20(22)25-18-8-4-3-5-9-18;1-2-13(14)16-11-7-6-10-15-12-8-4-3-5-9-12;;/h2,4-5,8-13H,1,6-7,14-15H2;2,4-5,8-9H,1,6-7,10-11H2;;/q2*-1;; |
| InChIKey | PTTRBHNUJVIEMT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|