C20H17N3O3S — CID 88910772
[2-(3-phenyl-6-propoxyindazol-1-yl)-1,3-thiazol-4-yl] formate (PubChem CID 88910772) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is [2-(3-phenyl-6-propoxyindazol-1-yl)-1,3-thiazol-4-yl] formate.
| Compound Name | [2-(3-phenyl-6-propoxyindazol-1-yl)-1,3-thiazol-4-yl] formate |
|---|---|
| PubChem CID | 88910772 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-(3-phenyl-6-propoxyindazol-1-yl)-1,3-thiazol-4-yl] formate |
| SMILES | CCCOc1ccc2c(-c3ccccc3)nn(-c3nc(OC=O)cs3)c2c1 |
| InChI | InChI=1S/C20H17N3O3S/c1-2-10-25-15-8-9-16-17(11-15)23(20-21-18(12-27-20)26-13-24)22-19(16)14-6-4-3-5-7-14/h3-9,11-13H,2,10H2,1H3 |
| InChIKey | GESIXKPGINVBEE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|