C22H34O4 — CID 88911142
(4Z,7Z,10Z,15Z,18Z)-12,13-dihydroxy-9-methylhenicosa-4,7,10,15,18-pentaenoic acid (PubChem CID 88911142) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4Z,7Z,10Z,15Z,18Z)-12,13-dihydroxy-9-methylhenicosa-4,7,10,15,18-pentaenoic acid.
| Compound Name | (4Z,7Z,10Z,15Z,18Z)-12,13-dihydroxy-9-methylhenicosa-4,7,10,15,18-pentaenoic acid |
|---|---|
| PubChem CID | 88911142 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4Z,7Z,10Z,15Z,18Z)-12,13-dihydroxy-9-methylhenicosa-4,7,10,15,18-pentaenoic acid |
| SMILES | CC/C=C\C/C=C\CC(O)C(O)/C=C\C(C)/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H34O4/c1-3-4-5-6-9-12-15-20(23)21(24)18-17-19(2)14-11-8-7-10-13-16-22(25)26/h4-5,7,9-12,14,17-21,23-24H,3,6,8,13,15-16H2,1-2H3,(H,25,26)/b5-4-,10-7-,12-9-,14-11-,18-17- |
| InChIKey | UCNZJRZLMUJHPI-BUPLHGNQSA-N |
| XLogP | 4.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|