C19H13F6N3O2 — CID 88911383
4-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-2H-chromene-6-carboxamide (PubChem CID 88911383) has the molecular formula C19H13F6N3O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is 4-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-2H-chromene-6-carboxamide.
| Compound Name | 4-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-2H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 88911383 |
| Molecular Formula | C19H13F6N3O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-2H-chromene-6-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)C(c1ccc(C(F)(F)F)cc1C(F)(F)F)=CCO2 |
| InChI | InChI=1S/C19H13F6N3O2/c20-18(21,22)10-2-3-12(14(8-10)19(23,24)25)11-5-6-30-15-4-1-9(7-13(11)15)16(29)28-17(26)27/h1-5,7-8H,6H2,(H4,26,27,28,29) |
| InChIKey | JWHXVSRBBSAZBI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|