C26H32F6N6O3 — CID 88911936
2-amino-3-methyl-1-[2-[[4-oxo-4-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]oxypyrrolidin-1-yl]butan-1-one (PubChem CID 88911936) has the molecular formula C26H32F6N6O3 and a molecular weight of 590.57 g/mol. Its IUPAC name is 2-amino-3-methyl-1-[2-[[4-oxo-4-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]oxypyrrolidin-1-yl]butan-1-one.
| Compound Name | 2-amino-3-methyl-1-[2-[[4-oxo-4-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]oxypyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 88911936 |
| Molecular Formula | C26H32F6N6O3 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-amino-3-methyl-1-[2-[[4-oxo-4-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]amino]oxypyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)C(N)C(=O)N1CCCC1ONC(CC(=O)C1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H32F6N6O3/c1-13(2)23(33)24(40)38-6-3-4-22(38)41-36-16(8-15-9-18(28)19(29)12-17(15)27)11-20(39)14-5-7-37-21(10-14)34-35-25(37)26(30,31)32/h9,12-14,16,22-23,36H,3-8,10-11,33H2,1-2H3 |
| InChIKey | UXQWGMJQZBFCJG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|