C20H25N3O3 — CID 88916148
N-[(4S)-4-formyl-10-methylidene-6-oxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]-3-phenylpropanamide (PubChem CID 88916148) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(4S)-4-formyl-10-methylidene-6-oxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]-3-phenylpropanamide.
| Compound Name | N-[(4S)-4-formyl-10-methylidene-6-oxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 88916148 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(4S)-4-formyl-10-methylidene-6-oxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepin-7-yl]-3-phenylpropanamide |
| SMILES | C=C1CCC(NC(=O)CCc2ccccc2)C(=O)N2[C@H](C=O)CCCN12 |
| InChI | InChI=1S/C20H25N3O3/c1-15-9-11-18(20(26)23-17(14-24)8-5-13-22(15)23)21-19(25)12-10-16-6-3-2-4-7-16/h2-4,6-7,14,17-18H,1,5,8-13H2,(H,21,25)/t17-,18?/m0/s1 |
| InChIKey | MDVGEIOXRBKSFL-ZENAZSQFSA-N |
| XLogP | 1.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|