C15H22BN3O7S — CID 88918699
CID 88918699 (PubChem CID 88918699) has the molecular formula C15H22BN3O7S and a molecular weight of 399.23 g/mol.
| Compound Name | CID 88918699 |
|---|---|
| PubChem CID | 88918699 |
| Molecular Formula | C15H22BN3O7S |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@@H](O/N=C(\C(=O)O)C1CSC(NC(=O)OC(C)(C)C)=N1)C(C)C |
| InChI | InChI=1S/C15H22BN3O7S/c1-7(2)10(12(22)25-16)26-19-9(11(20)21)8-6-27-13(17-8)18-14(23)24-15(3,4)5/h7-8,10H,6H2,1-5H3,(H,20,21)(H,17,18,23)/b19-9-/t8?,10-/m0/s1 |
| InChIKey | UESVWSIRKMFTBY-TURCZQKESA-N |
| XLogP | 1.09 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|