C21H33N3O7S — CID 88534046
tert-butyl 1-[(Z)-[2-ethoxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxycyclobutane-1-carboxylate (PubChem CID 88534046) has the molecular formula C21H33N3O7S and a molecular weight of 471.58 g/mol. Its IUPAC name is tert-butyl 1-[(Z)-[2-ethoxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxycyclobutane-1-carboxylate.
| Compound Name | tert-butyl 1-[(Z)-[2-ethoxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 88534046 |
| Molecular Formula | C21H33N3O7S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | tert-butyl 1-[(Z)-[2-ethoxy-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4,5-dihydro-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)/C(=N\OC1(C(=O)OC(C)(C)C)CCC1)C1CSC(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C21H33N3O7S/c1-8-28-15(25)14(13-12-32-17(22-13)23-18(27)30-20(5,6)7)24-31-21(10-9-11-21)16(26)29-19(2,3)4/h13H,8-12H2,1-7H3,(H,22,23,27)/b24-14- |
| InChIKey | JMDSSEMDTUBIRO-OYKKKHCWSA-N |
| XLogP | 3.18 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|