C18H23B2N3O7S — CID 123926204
CID 123926204 (PubChem CID 123926204) has the molecular formula C18H23B2N3O7S and a molecular weight of 447.09 g/mol.
| Compound Name | CID 123926204 |
|---|---|
| PubChem CID | 123926204 |
| Molecular Formula | C18H23B2N3O7S |
| Molecular Weight | 447.09 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(=NOC1(C(=O)OC(C)(C)C)CCC1)c1csc(N([B]C=O)[B]C=O)n1 |
| InChI | InChI=1S/C18H23B2N3O7S/c1-5-28-14(26)13(12-9-31-16(21-12)23(19-10-24)20-11-25)22-30-18(7-6-8-18)15(27)29-17(2,3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | NXYQDQRHARZKDT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 124.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.09 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|