C21H30N4O6S — CID 172929347
tert-butyl 1-methyl-4-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxypiperidine-4-carboxylate (PubChem CID 172929347) has the molecular formula C21H30N4O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is tert-butyl 1-methyl-4-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxypiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-methyl-4-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxypiperidine-4-carboxylate |
|---|---|
| PubChem CID | 172929347 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | tert-butyl 1-methyl-4-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxypiperidine-4-carboxylate |
| SMILES | Cc1nc(/C(=N/OC2(C(=O)OC(C)(C)C)CCN(C)CC2)C(=O)C[C@H]2CONC2=O)cs1 |
| InChI | InChI=1S/C21H30N4O6S/c1-13-22-15(12-32-13)17(16(26)10-14-11-29-24-18(14)27)23-31-21(6-8-25(5)9-7-21)19(28)30-20(2,3)4/h12,14H,6-11H2,1-5H3,(H,24,27)/b23-17-/t14-/m0/s1 |
| InChIKey | OEGDZVIEDZRRPF-UIFJYSFJSA-N |
| XLogP | 1.62 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|