C21H29N3O6S — CID 172935592
tert-butyl 3,3-dimethyl-1-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxycyclobutane-1-carboxylate (PubChem CID 172935592) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-1-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxycyclobutane-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethyl-1-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 172935592 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | tert-butyl 3,3-dimethyl-1-[(Z)-[1-(2-methyl-1,3-thiazol-4-yl)-2-oxo-3-[(4S)-3-oxo-1,2-oxazolidin-4-yl]propylidene]amino]oxycyclobutane-1-carboxylate |
| SMILES | Cc1nc(/C(=N/OC2(C(=O)OC(C)(C)C)CC(C)(C)C2)C(=O)C[C@H]2CONC2=O)cs1 |
| InChI | InChI=1S/C21H29N3O6S/c1-12-22-14(9-31-12)16(15(25)7-13-8-28-24-17(13)26)23-30-21(10-20(5,6)11-21)18(27)29-19(2,3)4/h9,13H,7-8,10-11H2,1-6H3,(H,24,26)/b23-16-/t13-/m0/s1 |
| InChIKey | PFKCLHYDRCILAK-SXNXEAAASA-N |
| XLogP | 2.71 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|