C8H5ClF2O — CID 88923166
2-(4-chloro-2,5-difluorophenyl)acetaldehyde (PubChem CID 88923166) has the molecular formula C8H5ClF2O and a molecular weight of 190.58 g/mol. Its IUPAC name is 2-(4-chloro-2,5-difluorophenyl)acetaldehyde.
| Compound Name | 2-(4-chloro-2,5-difluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 88923166 |
| Molecular Formula | C8H5ClF2O |
| Molecular Weight | 190.58 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 2-(4-chloro-2,5-difluorophenyl)acetaldehyde |
| SMILES | O=CCc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C8H5ClF2O/c9-6-4-7(10)5(1-2-12)3-8(6)11/h2-4H,1H2 |
| InChIKey | JYPXIUIMVZLXQM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|