About CID 88923535
CID 88923535 (PubChem CID 88923535) has the molecular formula C11H7BN4
and a molecular weight of 206.02 g/mol.
Molecular Properties
| Compound Name | CID 88923535 |
| PubChem CID | 88923535 |
| Molecular Formula | C11H7BN4 |
| Molecular Weight | 206.02 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2nnc(-c3ccccc3)n2c1 |
| InChI | InChI=1S/C11H7BN4/c12-9-6-13-11-15-14-10(16(11)7-9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | BWOGDOIANDDBTB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.02 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88923535 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88923535?
The IUPAC name of CID 88923535 (CID 88923535) is not available.
What is the SMILES notation for CID 88923535?
The canonical SMILES for CID 88923535 is [B]c1cnc2nnc(-c3ccccc3)n2c1.
What is the InChIKey of CID 88923535?
The InChIKey is BWOGDOIANDDBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BN4/c12-9-6-13-11-15-14-10(16(11)7-9)8-4-2-1-3-5-8/h1-7H.
What are the key properties of CID 88923535?
CID 88923535 has a molecular weight of 206.02 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88923535 is sourced from PubChem (CID 88923535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).