C29H43N7O6 — CID 88930231
N-[(2S)-1-[[4-(benzotriazol-1-ylmethylamino)-1-butoxy-3,4-dioxobutan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide (PubChem CID 88930231) has the molecular formula C29H43N7O6 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-[(2S)-1-[[4-(benzotriazol-1-ylmethylamino)-1-butoxy-3,4-dioxobutan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[4-(benzotriazol-1-ylmethylamino)-1-butoxy-3,4-dioxobutan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 88930231 |
| Molecular Formula | C29H43N7O6 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | N-[(2S)-1-[[4-(benzotriazol-1-ylmethylamino)-1-butoxy-3,4-dioxobutan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]morpholine-4-carboxamide |
| SMILES | CCCCOCC(NC(=O)[C@H](CC1CCCCC1)NC(=O)N1CCOCC1)C(=O)C(=O)NCn1nnc2ccccc21 |
| InChI | InChI=1S/C29H43N7O6/c1-2-3-15-42-19-24(26(37)28(39)30-20-36-25-12-8-7-11-22(25)33-34-36)31-27(38)23(18-21-9-5-4-6-10-21)32-29(40)35-13-16-41-17-14-35/h7-8,11-12,21,23-24H,2-6,9-10,13-20H2,1H3,(H,30,39)(H,31,38)(H,32,40)/t23-,24?/m0/s1 |
| InChIKey | NMDRPVYWCLHFBD-UXMRNZNESA-N |
| XLogP | 1.76 |
| TPSA | 156.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|