C19H36O5Si — CID 88931067
2-[(2R)-3-[(3R,4S,5R,6S)-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]ethanol (PubChem CID 88931067) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 2-[(2R)-3-[(3R,4S,5R,6S)-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]ethanol.
| Compound Name | 2-[(2R)-3-[(3R,4S,5R,6S)-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 88931067 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[(2R)-3-[(3R,4S,5R,6S)-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-5-methoxy-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]ethanol |
| SMILES | CO[C@@H]1[C@H](CC(C)(C)[Si](C)(C)O)CC[C@]2(CO2)[C@H]1C1(C)O[C@@H]1CCO |
| InChI | InChI=1S/C19H36O5Si/c1-17(2,25(5,6)21)11-13-7-9-19(12-23-19)16(15(13)22-4)18(3)14(24-18)8-10-20/h13-16,20-21H,7-12H2,1-6H3/t13-,14+,15+,16+,18?,19-/m0/s1 |
| InChIKey | ZIUDRLJGDXFZST-JZKKOQEESA-N |
| XLogP | 2.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|