C12H26O5P+ — CID 88943906
(2,4-diethyl-2,4-dimethyl-5-oxohexoxy)-trihydroxyphosphanium (PubChem CID 88943906) has the molecular formula C12H26O5P+ and a molecular weight of 281.31 g/mol. Its IUPAC name is (2,4-diethyl-2,4-dimethyl-5-oxohexoxy)-trihydroxyphosphanium.
| Compound Name | (2,4-diethyl-2,4-dimethyl-5-oxohexoxy)-trihydroxyphosphanium |
|---|---|
| PubChem CID | 88943906 |
| Molecular Formula | C12H26O5P+ |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2,4-diethyl-2,4-dimethyl-5-oxohexoxy)-trihydroxyphosphanium |
| SMILES | CCC(C)(CO[P+](O)(O)O)CC(C)(CC)C(C)=O |
| InChI | InChI=1S/C12H26O5P/c1-6-11(4,9-17-18(14,15)16)8-12(5,7-2)10(3)13/h14-16H,6-9H2,1-5H3/q+1 |
| InChIKey | VXGHJOQGMXVUHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|