C23H25ClN5O3+ — CID 88949946
[3-chloro-4-[4-[3-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl]piperazin-1-yl]phenyl]-methyl-oxoazanium (PubChem CID 88949946) has the molecular formula C23H25ClN5O3+ and a molecular weight of 454.94 g/mol. Its IUPAC name is [3-chloro-4-[4-[3-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl]piperazin-1-yl]phenyl]-methyl-oxoazanium.
| Compound Name | [3-chloro-4-[4-[3-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl]piperazin-1-yl]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 88949946 |
| Molecular Formula | C23H25ClN5O3+ |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [3-chloro-4-[4-[3-(2-methoxyphenyl)-5-methyl-1H-pyrazole-4-carbonyl]piperazin-1-yl]phenyl]-methyl-oxoazanium |
| SMILES | COc1ccccc1-c1n[nH]c(C)c1C(=O)N1CCN(c2ccc([N+](C)=O)cc2Cl)CC1 |
| InChI | InChI=1S/C23H24ClN5O3/c1-15-21(22(26-25-15)17-6-4-5-7-20(17)32-3)23(30)29-12-10-28(11-13-29)19-9-8-16(27(2)31)14-18(19)24/h4-9,14H,10-13H2,1-3H3/p+1 |
| InChIKey | SBAWGBLABLHVEQ-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|