C33H44F4O2 — CID 88953413
2-[4-[(2E,4Z)-6-[[2,3-difluoro-4-(4-pentylcyclohexyl)cyclohex-2-en-1-yl]methoxy]hepta-2,4,6-trien-3-yl]-2,3-difluorocyclohexa-2,4-dien-1-yl]oxirane (PubChem CID 88953413) has the molecular formula C33H44F4O2 and a molecular weight of 548.71 g/mol. Its IUPAC name is 2-[4-[(2E,4Z)-6-[[2,3-difluoro-4-(4-pentylcyclohexyl)cyclohex-2-en-1-yl]methoxy]hepta-2,4,6-trien-3-yl]-2,3-difluorocyclohexa-2,4-dien-1-yl]oxirane.
| Compound Name | 2-[4-[(2E,4Z)-6-[[2,3-difluoro-4-(4-pentylcyclohexyl)cyclohex-2-en-1-yl]methoxy]hepta-2,4,6-trien-3-yl]-2,3-difluorocyclohexa-2,4-dien-1-yl]oxirane |
|---|---|
| PubChem CID | 88953413 |
| Molecular Formula | C33H44F4O2 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 2-[4-[(2E,4Z)-6-[[2,3-difluoro-4-(4-pentylcyclohexyl)cyclohex-2-en-1-yl]methoxy]hepta-2,4,6-trien-3-yl]-2,3-difluorocyclohexa-2,4-dien-1-yl]oxirane |
| SMILES | C=C(/C=C\C(=C/C)C1=CCC(C2CO2)C(F)=C1F)OCC1CCC(C2CCC(CCCCC)CC2)C(F)=C1F |
| InChI | InChI=1S/C33H44F4O2/c1-4-6-7-8-22-10-13-24(14-11-22)27-16-15-25(30(34)31(27)35)19-38-21(3)9-12-23(5-2)26-17-18-28(29-20-39-29)33(37)32(26)36/h5,9,12,17,22,24-25,27-29H,3-4,6-8,10-11,13-16,18-20H2,1-2H3/b12-9-,23-5+ |
| InChIKey | QUAHCKKJRHDCCP-USNRENLUSA-N |
| XLogP | 10.08 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|