C34H36F4O3 — CID 88953654
1-[4-[4-[4-[(2,3-difluoro-4-pent-4-ynoxyphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]phenyl]butan-1-ol (PubChem CID 88953654) has the molecular formula C34H36F4O3 and a molecular weight of 568.65 g/mol. Its IUPAC name is 1-[4-[4-[4-[(2,3-difluoro-4-pent-4-ynoxyphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]phenyl]butan-1-ol.
| Compound Name | 1-[4-[4-[4-[(2,3-difluoro-4-pent-4-ynoxyphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 88953654 |
| Molecular Formula | C34H36F4O3 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 1-[4-[4-[4-[(2,3-difluoro-4-pent-4-ynoxyphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]phenyl]butan-1-ol |
| SMILES | C#CCCCOc1ccc(COC2CCC(c3ccc(-c4ccc(C(O)CCC)cc4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H36F4O3/c1-3-5-6-20-40-30-19-14-25(31(35)34(30)38)21-41-26-15-12-23(13-16-26)28-18-17-27(32(36)33(28)37)22-8-10-24(11-9-22)29(39)7-4-2/h1,8-11,14,17-19,23,26,29,39H,4-7,12-13,15-16,20-21H2,2H3 |
| InChIKey | FPDFZOMKRLAIFH-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|