C11H12N2 — CID 88962072
(1Z)-2-[(Z)-(2-methylidene-3-pyridinylidene)methyl]buta-1,3-dien-1-amine (PubChem CID 88962072) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (1Z)-2-[(Z)-(2-methylidene-3-pyridinylidene)methyl]buta-1,3-dien-1-amine.
| Compound Name | (1Z)-2-[(Z)-(2-methylidene-3-pyridinylidene)methyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88962072 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (1Z)-2-[(Z)-(2-methylidene-3-pyridinylidene)methyl]buta-1,3-dien-1-amine |
| SMILES | C=CC(=C/N)/C=c1/cccnc1=C |
| InChI | InChI=1S/C11H12N2/c1-3-10(8-12)7-11-5-4-6-13-9(11)2/h3-8H,1-2,12H2/b10-8-,11-7- |
| InChIKey | OJMPRAWZHIDUIB-ACBQZUGDSA-N |
| XLogP | 0.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|