C13H24IN3O — CID 88963415
4-(iodoamino)-N-(2-pyrrolidin-1-ylethyl)cyclohexane-1-carboxamide (PubChem CID 88963415) has the molecular formula C13H24IN3O and a molecular weight of 365.26 g/mol. Its IUPAC name is 4-(iodoamino)-N-(2-pyrrolidin-1-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(iodoamino)-N-(2-pyrrolidin-1-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 88963415 |
| Molecular Formula | C13H24IN3O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(iodoamino)-N-(2-pyrrolidin-1-ylethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCN1CCCC1)C1CCC(NI)CC1 |
| InChI | InChI=1S/C13H24IN3O/c14-16-12-5-3-11(4-6-12)13(18)15-7-10-17-8-1-2-9-17/h11-12,16H,1-10H2,(H,15,18) |
| InChIKey | AOFCVSKJHVHYAX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|