C13H18N2O4 — CID 88964930
6-[4-[(Z)-hydrazinylidenemethyl]phenoxy]-2-(hydroxymethyl)oxan-3-ol (PubChem CID 88964930) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-[4-[(Z)-hydrazinylidenemethyl]phenoxy]-2-(hydroxymethyl)oxan-3-ol.
| Compound Name | 6-[4-[(Z)-hydrazinylidenemethyl]phenoxy]-2-(hydroxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 88964930 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-[4-[(Z)-hydrazinylidenemethyl]phenoxy]-2-(hydroxymethyl)oxan-3-ol |
| SMILES | N/N=C\c1ccc(OC2CCC(O)C(CO)O2)cc1 |
| InChI | InChI=1S/C13H18N2O4/c14-15-7-9-1-3-10(4-2-9)18-13-6-5-11(17)12(8-16)19-13/h1-4,7,11-13,16-17H,5-6,8,14H2/b15-7- |
| InChIKey | OLUCEOAGSNGGKE-CHHVJCJISA-N |
| XLogP | 0.22 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|