C14H19N3O6S — CID 45485923
[(Z)-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]thiourea (PubChem CID 45485923) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is [(Z)-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]thiourea.
| Compound Name | [(Z)-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 45485923 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [(Z)-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C\c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H19N3O6S/c15-14(24)17-16-5-7-1-3-8(4-2-7)22-13-12(21)11(20)10(19)9(6-18)23-13/h1-5,9-13,18-21H,6H2,(H3,15,17,24)/b16-5-/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | DBGYDWDJCGBBIX-LIXADGMHSA-N |
| XLogP | -1.97 |
| TPSA | 149.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|