C19H21N3O7 — CID 3380016
N-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 3380016) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3380016 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1)c1ccncc1 |
| InChI | InChI=1S/C19H21N3O7/c23-10-14-15(24)16(25)17(26)19(29-14)28-13-3-1-11(2-4-13)9-21-22-18(27)12-5-7-20-8-6-12/h1-9,14-17,19,23-26H,10H2,(H,22,27) |
| InChIKey | JLTKHQOIUGCLNI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|