C25H26F3N3O3 — CID 88967764
N-(2-cyclopropylethyl)-2-formyl-4-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzamide (PubChem CID 88967764) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-2-formyl-4-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzamide.
| Compound Name | N-(2-cyclopropylethyl)-2-formyl-4-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 88967764 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-(2-cyclopropylethyl)-2-formyl-4-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzamide |
| SMILES | O=Cc1cc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)ccc1C(=O)NCCC1CC1 |
| InChI | InChI=1S/C25H26F3N3O3/c26-25(27,28)22-4-2-1-3-21(22)24(34)31-13-11-30(12-14-31)19-7-8-20(18(15-19)16-32)23(33)29-10-9-17-5-6-17/h1-4,7-8,15-17H,5-6,9-14H2,(H,29,33) |
| InChIKey | ZPGVGFVJOHXIDW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|