C14H27NO2 — CID 88975041
(Z)-12-hydroxy-N,N-dimethyldodec-7-enamide (PubChem CID 88975041) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (Z)-12-hydroxy-N,N-dimethyldodec-7-enamide.
| Compound Name | (Z)-12-hydroxy-N,N-dimethyldodec-7-enamide |
|---|---|
| PubChem CID | 88975041 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (Z)-12-hydroxy-N,N-dimethyldodec-7-enamide |
| SMILES | CN(C)C(=O)CCCCC/C=C\CCCCO |
| InChI | InChI=1S/C14H27NO2/c1-15(2)14(17)12-10-8-6-4-3-5-7-9-11-13-16/h3,5,16H,4,6-13H2,1-2H3/b5-3- |
| InChIKey | BCMGDOIYBGNYFV-HYXAFXHYSA-N |
| XLogP | 2.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|