C19H25BN2O3 — CID 88976195
CID 88976195 (PubChem CID 88976195) has the molecular formula C19H25BN2O3 and a molecular weight of 340.23 g/mol.
| Compound Name | CID 88976195 |
|---|---|
| PubChem CID | 88976195 |
| Molecular Formula | C19H25BN2O3 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)NC(=O)C21CCC(OCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C19H25BN2O3/c20-14-1-2-16-17(13-14)21-18(23)19(16)5-3-15(4-6-19)25-12-9-22-7-10-24-11-8-22/h1-2,13,15H,3-12H2,(H,21,23) |
| InChIKey | LSRBCCRQEVVEBW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|