C7H11BrO3 — CID 88976614
(2R,3R,5S)-2-[(Z)-2-bromoethenyl]-5-methyloxolane-3,4-diol (PubChem CID 88976614) has the molecular formula C7H11BrO3 and a molecular weight of 223.07 g/mol. Its IUPAC name is (2R,3R,5S)-2-[(Z)-2-bromoethenyl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,5S)-2-[(Z)-2-bromoethenyl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 88976614 |
| Molecular Formula | C7H11BrO3 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (2R,3R,5S)-2-[(Z)-2-bromoethenyl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@@H]1O[C@H](/C=C\Br)[C@H](O)C1O |
| InChI | InChI=1S/C7H11BrO3/c1-4-6(9)7(10)5(11-4)2-3-8/h2-7,9-10H,1H3/b3-2-/t4-,5+,6?,7-/m0/s1 |
| InChIKey | PSNNRPUQCXUJBX-QYOUTPCWSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |