C8H12O3 — CID 54334104
2,5-bis(ethenyl)oxolane-3,4-diol (PubChem CID 54334104) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2,5-bis(ethenyl)oxolane-3,4-diol.
| Compound Name | 2,5-bis(ethenyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 54334104 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2,5-bis(ethenyl)oxolane-3,4-diol |
| SMILES | C=CC1OC(C=C)C(O)C1O |
| InChI | InChI=1S/C8H12O3/c1-3-5-7(9)8(10)6(4-2)11-5/h3-10H,1-2H2 |
| InChIKey | TUFUDPLGLVHRKV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|