About heptylbenzene;oxocobalt;phenyl benzoate
heptylbenzene;oxocobalt;phenyl benzoate (PubChem CID 88980212) has the molecular formula C26H28CoO3-2
and a molecular weight of 447.44 g/mol. Its IUPAC name is heptylbenzene;oxocobalt;phenyl benzoate.
Molecular Properties
| Compound Name | heptylbenzene;oxocobalt;phenyl benzoate |
| PubChem CID | 88980212 |
| Molecular Formula | C26H28CoO3-2 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | heptylbenzene;oxocobalt;phenyl benzoate |
| SMILES | CCCCCCCc1cc[c-]cc1.O=C(Oc1ccccc1)c1cc[c-]cc1.O=[Co] |
| InChI | InChI=1S/C13H9O2.C13H19.Co.O/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-2-3-4-5-7-10-13-11-8-6-9-12-13;;/h2-10H;8-9,11-12H,2-5,7,10H2,1H3;;/q2*-1;; |
| InChIKey | FGYJYGGPEMKOKO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze heptylbenzene;oxocobalt;phenyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptylbenzene;oxocobalt;phenyl benzoate?
The IUPAC name of heptylbenzene;oxocobalt;phenyl benzoate (CID 88980212) is heptylbenzene;oxocobalt;phenyl benzoate.
What is the SMILES notation for heptylbenzene;oxocobalt;phenyl benzoate?
The canonical SMILES for heptylbenzene;oxocobalt;phenyl benzoate is CCCCCCCc1cc[c-]cc1.O=C(Oc1ccccc1)c1cc[c-]cc1.O=[Co].
What is the InChIKey of heptylbenzene;oxocobalt;phenyl benzoate?
The InChIKey is FGYJYGGPEMKOKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9O2.C13H19.Co.O/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12;1-2-3-4-5-7-10-13-11-8-6-9-12-13;;/h2-10H;8-9,11-12H,2-5,7,10H2,1H3;;/q2*-1;;.
What are the key properties of heptylbenzene;oxocobalt;phenyl benzoate?
heptylbenzene;oxocobalt;phenyl benzoate has a molecular weight of 447.44 g/mol, XLogP of 6.58, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptylbenzene;oxocobalt;phenyl benzoate is sourced from PubChem (CID 88980212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).