C61H61F6N3S2 — CID 88981097
9-heptadecan-9-yl-2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxalin-5-yl]thiophen-2-yl]carbazole (PubChem CID 88981097) has the molecular formula C61H61F6N3S2 and a molecular weight of 1014.30 g/mol. Its IUPAC name is 9-heptadecan-9-yl-2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxalin-5-yl]thiophen-2-yl]carbazole.
| Compound Name | 9-heptadecan-9-yl-2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxalin-5-yl]thiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 88981097 |
| Molecular Formula | C61H61F6N3S2 |
| Molecular Weight | 1014.30 g/mol |
| Exact Mass | 1013.42 |
| IUPAC Name | 9-heptadecan-9-yl-2-methyl-7-[5-[8-(5-methylthiophen-2-yl)-2,3-bis[4-(trifluoromethyl)phenyl]quinoxalin-5-yl]thiophen-2-yl]carbazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(C)ccc2c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(C(F)(F)F)cc6)c(-c6ccc(C(F)(F)F)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C61H61F6N3S2/c1-5-7-9-11-13-15-17-46(18-16-14-12-10-8-6-2)70-51-37-39(3)19-30-47(51)48-31-25-43(38-52(48)70)53-35-36-55(72-53)50-33-32-49(54-34-20-40(4)71-54)58-59(50)69-57(42-23-28-45(29-24-42)61(65,66)67)56(68-58)41-21-26-44(27-22-41)60(62,63)64/h19-38,46H,5-18H2,1-4H3 |
| InChIKey | QGKKGYALAMSPCM-UHFFFAOYSA-N |
| XLogP | 20.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.30 |
| LogP ≤ 5 | 20.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|