C8H13NO — CID 88982778
(2-methoxycyclohexa-2,4-dien-1-yl)methanamine (PubChem CID 88982778) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2-methoxycyclohexa-2,4-dien-1-yl)methanamine.
| Compound Name | (2-methoxycyclohexa-2,4-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 88982778 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2-methoxycyclohexa-2,4-dien-1-yl)methanamine |
| SMILES | COC1=CC=CCC1CN |
| InChI | InChI=1S/C8H13NO/c1-10-8-5-3-2-4-7(8)6-9/h2-3,5,7H,4,6,9H2,1H3 |
| InChIKey | HTISQEQZYCJJSB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |