C54H30F4N4 — CID 88985078
4-(N-[6-(4-cyano-N-(3,4-difluoro-5-phenylphenyl)anilino)pyren-1-yl]-3,4-difluoro-5-phenylanilino)benzonitrile (PubChem CID 88985078) has the molecular formula C54H30F4N4 and a molecular weight of 810.85 g/mol. Its IUPAC name is 4-(N-[6-(4-cyano-N-(3,4-difluoro-5-phenylphenyl)anilino)pyren-1-yl]-3,4-difluoro-5-phenylanilino)benzonitrile.
| Compound Name | 4-(N-[6-(4-cyano-N-(3,4-difluoro-5-phenylphenyl)anilino)pyren-1-yl]-3,4-difluoro-5-phenylanilino)benzonitrile |
|---|---|
| PubChem CID | 88985078 |
| Molecular Formula | C54H30F4N4 |
| Molecular Weight | 810.85 g/mol |
| Exact Mass | 810.24 |
| IUPAC Name | 4-(N-[6-(4-cyano-N-(3,4-difluoro-5-phenylphenyl)anilino)pyren-1-yl]-3,4-difluoro-5-phenylanilino)benzonitrile |
| SMILES | N#Cc1ccc(N(c2cc(F)c(F)c(-c3ccccc3)c2)c2ccc3ccc4c(N(c5ccc(C#N)cc5)c5cc(F)c(F)c(-c6ccccc6)c5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C54H30F4N4/c55-47-29-41(27-45(53(47)57)35-7-3-1-4-8-35)61(39-19-11-33(31-59)12-20-39)49-25-17-37-16-24-44-50(26-18-38-15-23-43(49)51(37)52(38)44)62(40-21-13-34(32-60)14-22-40)42-28-46(54(58)48(56)30-42)36-9-5-2-6-10-36/h1-30H |
| InChIKey | XHALIMHXTGHZPZ-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.85 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|