C28H26BN7O — CID 88986734
CID 88986734 (PubChem CID 88986734) has the molecular formula C28H26BN7O and a molecular weight of 487.38 g/mol.
| Compound Name | CID 88986734 |
|---|---|
| PubChem CID | 88986734 |
| Molecular Formula | C28H26BN7O |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCCN(C(=O)/C=C/c4c[nH]c5ccccc45)C3)nc12 |
| InChI | InChI=1S/C28H26BN7O/c29-23-17-33-36-26(32-15-19-5-3-11-30-14-19)13-25(34-28(23)36)21-6-4-12-35(18-21)27(37)10-9-20-16-31-24-8-2-1-7-22(20)24/h1-3,5,7-11,13-14,16-17,21,31-32H,4,6,12,15,18H2/b10-9+ |
| InChIKey | AACPYOHOKDAMLL-MDZDMXLPSA-N |
| XLogP | 3.43 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|