C23H22BFN6O2S — CID 89230995
CID 89230995 (PubChem CID 89230995) has the molecular formula C23H22BFN6O2S and a molecular weight of 476.35 g/mol.
| Compound Name | CID 89230995 |
|---|---|
| PubChem CID | 89230995 |
| Molecular Formula | C23H22BFN6O2S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NCc3cccnc3)cc(C3CCCN(S(=O)(=O)c4ccc(F)cc4)C3)nc12 |
| InChI | InChI=1S/C23H22BFN6O2S/c24-20-14-28-31-22(27-13-16-3-1-9-26-12-16)11-21(29-23(20)31)17-4-2-10-30(15-17)34(32,33)19-7-5-18(25)6-8-19/h1,3,5-9,11-12,14,17,27H,2,4,10,13,15H2 |
| InChIKey | QTDSXCSSUYZCOH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|